C31H26BrNO2 — CID 139241885
10-(4-bromophenyl)-9-(4-phenylphenyl)-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione (PubChem CID 139241885) has the molecular formula C31H26BrNO2 and a molecular weight of 524.46 g/mol. Its IUPAC name is 10-(4-bromophenyl)-9-(4-phenylphenyl)-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione.
| Compound Name | 10-(4-bromophenyl)-9-(4-phenylphenyl)-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 139241885 |
| Molecular Formula | C31H26BrNO2 |
| Molecular Weight | 524.46 g/mol |
| Exact Mass | 523.11 |
| IUPAC Name | 10-(4-bromophenyl)-9-(4-phenylphenyl)-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione |
| SMILES | O=C1CCCC2=C1C(c1ccc(-c3ccccc3)cc1)C1=C(CCCC1=O)N2c1ccc(Br)cc1 |
| InChI | InChI=1S/C31H26BrNO2/c32-23-16-18-24(19-17-23)33-25-8-4-10-27(34)30(25)29(31-26(33)9-5-11-28(31)35)22-14-12-21(13-15-22)20-6-2-1-3-7-20/h1-3,6-7,12-19,29H,4-5,8-11H2 |
| InChIKey | XSETXWCMVZDXFY-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.46 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |