C44H38Br2N2O4 — CID 139241887
10-(4-bromophenyl)-9-[4-[10-(4-bromophenyl)-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl]phenyl]-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione (PubChem CID 139241887) has the molecular formula C44H38Br2N2O4 and a molecular weight of 818.61 g/mol. Its IUPAC name is 10-(4-bromophenyl)-9-[4-[10-(4-bromophenyl)-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl]phenyl]-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione.
| Compound Name | 10-(4-bromophenyl)-9-[4-[10-(4-bromophenyl)-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl]phenyl]-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 139241887 |
| Molecular Formula | C44H38Br2N2O4 |
| Molecular Weight | 818.61 g/mol |
| Exact Mass | 816.12 |
| IUPAC Name | 10-(4-bromophenyl)-9-[4-[10-(4-bromophenyl)-1,8-dioxo-3,4,5,6,7,9-hexahydro-2H-acridin-9-yl]phenyl]-3,4,5,6,7,9-hexahydro-2H-acridine-1,8-dione |
| SMILES | O=C1CCCC2=C1C(c1ccc(C3C4=C(CCCC4=O)N(c4ccc(Br)cc4)C4=C3C(=O)CCC4)cc1)C1=C(CCCC1=O)N2c1ccc(Br)cc1 |
| InChI | InChI=1S/C44H38Br2N2O4/c45-27-17-21-29(22-18-27)47-31-5-1-9-35(49)41(31)39(42-32(47)6-2-10-36(42)50)25-13-15-26(16-14-25)40-43-33(7-3-11-37(43)51)48(30-23-19-28(46)20-24-30)34-8-4-12-38(52)44(34)40/h13-24,39-40H,1-12H2 |
| InChIKey | AZQMWSVLTZVSLG-UHFFFAOYSA-N |
| XLogP | 10.45 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.61 |
| LogP ≤ 5 | 10.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |