C33H32BrNO2 — CID 139241884
10-(4-bromophenyl)-3,3,6,6-tetramethyl-9-naphthalen-1-yl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 139241884) has the molecular formula C33H32BrNO2 and a molecular weight of 554.53 g/mol. Its IUPAC name is 10-(4-bromophenyl)-3,3,6,6-tetramethyl-9-naphthalen-1-yl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 10-(4-bromophenyl)-3,3,6,6-tetramethyl-9-naphthalen-1-yl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 139241884 |
| Molecular Formula | C33H32BrNO2 |
| Molecular Weight | 554.53 g/mol |
| Exact Mass | 553.16 |
| IUPAC Name | 10-(4-bromophenyl)-3,3,6,6-tetramethyl-9-naphthalen-1-yl-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)N(c1ccc(Br)cc1)C1=C(C(=O)CC(C)(C)C1)C2c1cccc2ccccc12 |
| InChI | InChI=1S/C33H32BrNO2/c1-32(2)16-25-30(27(36)18-32)29(24-11-7-9-20-8-5-6-10-23(20)24)31-26(17-33(3,4)19-28(31)37)35(25)22-14-12-21(34)13-15-22/h5-15,29H,16-19H2,1-4H3 |
| InChIKey | HQVNRWZRRMBINU-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.53 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |