C35H34BrNO2 — CID 139241883
10-(4-bromophenyl)-3,3,6,6-tetramethyl-9-(4-phenylphenyl)-4,5,7,9-tetrahydro-2H-acridine-1,8-dione (PubChem CID 139241883) has the molecular formula C35H34BrNO2 and a molecular weight of 580.57 g/mol. Its IUPAC name is 10-(4-bromophenyl)-3,3,6,6-tetramethyl-9-(4-phenylphenyl)-4,5,7,9-tetrahydro-2H-acridine-1,8-dione.
| Compound Name | 10-(4-bromophenyl)-3,3,6,6-tetramethyl-9-(4-phenylphenyl)-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
|---|---|
| PubChem CID | 139241883 |
| Molecular Formula | C35H34BrNO2 |
| Molecular Weight | 580.57 g/mol |
| Exact Mass | 579.18 |
| IUPAC Name | 10-(4-bromophenyl)-3,3,6,6-tetramethyl-9-(4-phenylphenyl)-4,5,7,9-tetrahydro-2H-acridine-1,8-dione |
| SMILES | CC1(C)CC(=O)C2=C(C1)N(c1ccc(Br)cc1)C1=C(C(=O)CC(C)(C)C1)C2c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C35H34BrNO2/c1-34(2)18-27-32(29(38)20-34)31(24-12-10-23(11-13-24)22-8-6-5-7-9-22)33-28(19-35(3,4)21-30(33)39)37(27)26-16-14-25(36)15-17-26/h5-17,31H,18-21H2,1-4H3 |
| InChIKey | CGOBSVUNTZSITE-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.57 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |