C46H53NO7 — CID 139242021
(2R)-N-(3-cyclopenta-1,3-dien-1-ylpropyl)-2-methyl-3-[(2R,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypropanamide (PubChem CID 139242021) has the molecular formula C46H53NO7 and a molecular weight of 731.93 g/mol. Its IUPAC name is (2R)-N-(3-cyclopenta-1,3-dien-1-ylpropyl)-2-methyl-3-[(2R,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypropanamide.
| Compound Name | (2R)-N-(3-cyclopenta-1,3-dien-1-ylpropyl)-2-methyl-3-[(2R,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypropanamide |
|---|---|
| PubChem CID | 139242021 |
| Molecular Formula | C46H53NO7 |
| Molecular Weight | 731.93 g/mol |
| Exact Mass | 731.38 |
| IUPAC Name | (2R)-N-(3-cyclopenta-1,3-dien-1-ylpropyl)-2-methyl-3-[(2R,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypropanamide |
| SMILES | C[C@H](CO[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1)C(=O)NCCCC1=CC=CC1 |
| InChI | InChI=1S/C46H53NO7/c1-35(45(48)47-28-16-27-36-17-14-15-18-36)29-53-46-44(52-33-40-25-12-5-13-26-40)43(51-32-39-23-10-4-11-24-39)42(50-31-38-21-8-3-9-22-38)41(54-46)34-49-30-37-19-6-2-7-20-37/h2-15,17,19-26,35,41-44,46H,16,18,27-34H2,1H3,(H,47,48)/t35-,41-,42-,43+,44+,46-/m1/s1 |
| InChIKey | QGURQOBYQRUIPP-BDOBGKMFSA-N |
| XLogP | 8.12 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 731.93 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|