C47H55NO7 — CID 139242023
(2R)-N-(4-cyclopenta-1,3-dien-1-ylbutyl)-2-methyl-3-[(3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypropanamide (PubChem CID 139242023) has the molecular formula C47H55NO7 and a molecular weight of 745.96 g/mol. Its IUPAC name is (2R)-N-(4-cyclopenta-1,3-dien-1-ylbutyl)-2-methyl-3-[(3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypropanamide.
| Compound Name | (2R)-N-(4-cyclopenta-1,3-dien-1-ylbutyl)-2-methyl-3-[(3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypropanamide |
|---|---|
| PubChem CID | 139242023 |
| Molecular Formula | C47H55NO7 |
| Molecular Weight | 745.96 g/mol |
| Exact Mass | 745.40 |
| IUPAC Name | (2R)-N-(4-cyclopenta-1,3-dien-1-ylbutyl)-2-methyl-3-[(3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypropanamide |
| SMILES | C[C@H](COC1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1)C(=O)NCCCCC1=CC=CC1 |
| InChI | InChI=1S/C47H55NO7/c1-36(46(49)48-29-17-16-20-37-18-14-15-19-37)30-54-47-45(53-34-41-27-12-5-13-28-41)44(52-33-40-25-10-4-11-26-40)43(51-32-39-23-8-3-9-24-39)42(55-47)35-50-31-38-21-6-2-7-22-38/h2-15,18,21-28,36,42-45,47H,16-17,19-20,29-35H2,1H3,(H,48,49)/t36-,42-,43-,44+,45+,47?/m1/s1 |
| InChIKey | SRRXMBIOAYWCHY-DFRDHMFMSA-N |
| XLogP | 8.51 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 745.96 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|