C10H4F3N2- — CID 139243045
[2-(3-cyanophenyl)-3,3,3-trifluoroprop-1-enylidene]azanide (PubChem CID 139243045) has the molecular formula C10H4F3N2- and a molecular weight of 209.15 g/mol. Its IUPAC name is [2-(3-cyanophenyl)-3,3,3-trifluoroprop-1-enylidene]azanide.
| Compound Name | [2-(3-cyanophenyl)-3,3,3-trifluoroprop-1-enylidene]azanide |
|---|---|
| PubChem CID | 139243045 |
| Molecular Formula | C10H4F3N2- |
| Molecular Weight | 209.15 g/mol |
| Exact Mass | 209.03 |
| IUPAC Name | [2-(3-cyanophenyl)-3,3,3-trifluoroprop-1-enylidene]azanide |
| SMILES | N#Cc1cccc(C(=C=[N-])C(F)(F)F)c1 |
| InChI | InChI=1S/C10H4F3N2/c11-10(12,13)9(6-15)8-3-1-2-7(4-8)5-14/h1-4H/q-1 |
| InChIKey | PAFPJNMSUDTYCT-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.15 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|