C9H9ClF6 — CID 139243157
1-tert-butyl-2-chloro-3,3,4,4,5,5-hexafluorocyclopentene (PubChem CID 139243157) has the molecular formula C9H9ClF6 and a molecular weight of 266.61 g/mol. Its IUPAC name is 1-tert-butyl-2-chloro-3,3,4,4,5,5-hexafluorocyclopentene.
| Compound Name | 1-tert-butyl-2-chloro-3,3,4,4,5,5-hexafluorocyclopentene |
|---|---|
| PubChem CID | 139243157 |
| Molecular Formula | C9H9ClF6 |
| Molecular Weight | 266.61 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | 1-tert-butyl-2-chloro-3,3,4,4,5,5-hexafluorocyclopentene |
| SMILES | CC(C)(C)C1=C(Cl)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C9H9ClF6/c1-6(2,3)4-5(10)8(13,14)9(15,16)7(4,11)12/h1-3H3 |
| InChIKey | FJOGAPDFYBPBFT-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.61 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|