C9H9F7 — CID 170031264
1-tert-butyl-2,3,3,4,4,5,5-heptafluorocyclopentene (PubChem CID 170031264) has the molecular formula C9H9F7 and a molecular weight of 250.16 g/mol. Its IUPAC name is 1-tert-butyl-2,3,3,4,4,5,5-heptafluorocyclopentene.
| Compound Name | 1-tert-butyl-2,3,3,4,4,5,5-heptafluorocyclopentene |
|---|---|
| PubChem CID | 170031264 |
| Molecular Formula | C9H9F7 |
| Molecular Weight | 250.16 g/mol |
| Exact Mass | 250.06 |
| IUPAC Name | 1-tert-butyl-2,3,3,4,4,5,5-heptafluorocyclopentene |
| SMILES | CC(C)(C)C1=C(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C9H9F7/c1-6(2,3)4-5(10)8(13,14)9(15,16)7(4,11)12/h1-3H3 |
| InChIKey | COVCQBDYHRPYHF-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.16 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|