About CID 139244857
CID 139244857 (PubChem CID 139244857) has the molecular formula C19H18O2
and a molecular weight of 278.35 g/mol.
Molecular Properties
| Compound Name | CID 139244857 |
| PubChem CID | 139244857 |
| Molecular Formula | C19H18O2 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | — |
| SMILES | CC(=O)c1ccc([CH]C[CH]c2ccc(C(C)=O)cc2)cc1 |
| InChI | InChI=1S/C19H18O2/c1-14(20)18-10-6-16(7-11-18)4-3-5-17-8-12-19(13-9-17)15(2)21/h4-13H,3H2,1-2H3 |
| InChIKey | NWYUYCBOZSFWEQ-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 139244857 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139244857?
The IUPAC name of CID 139244857 (CID 139244857) is not available.
What is the SMILES notation for CID 139244857?
The canonical SMILES for CID 139244857 is CC(=O)c1ccc([CH]C[CH]c2ccc(C(C)=O)cc2)cc1.
What is the InChIKey of CID 139244857?
The InChIKey is NWYUYCBOZSFWEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18O2/c1-14(20)18-10-6-16(7-11-18)4-3-5-17-8-12-19(13-9-17)15(2)21/h4-13H,3H2,1-2H3.
What are the key properties of CID 139244857?
CID 139244857 has a molecular weight of 278.35 g/mol, XLogP of 4.29, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139244857 is sourced from PubChem (CID 139244857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).