C21H20ClNS2 — CID 139246285
4-[4-[2-(5-chloro-2-methylthiophen-3-yl)cyclopenten-1-yl]-5-methylthiophen-2-yl]aniline (PubChem CID 139246285) has the molecular formula C21H20ClNS2 and a molecular weight of 385.99 g/mol. Its IUPAC name is 4-[4-[2-(5-chloro-2-methylthiophen-3-yl)cyclopenten-1-yl]-5-methylthiophen-2-yl]aniline.
| Compound Name | 4-[4-[2-(5-chloro-2-methylthiophen-3-yl)cyclopenten-1-yl]-5-methylthiophen-2-yl]aniline |
|---|---|
| PubChem CID | 139246285 |
| Molecular Formula | C21H20ClNS2 |
| Molecular Weight | 385.99 g/mol |
| Exact Mass | 385.07 |
| IUPAC Name | 4-[4-[2-(5-chloro-2-methylthiophen-3-yl)cyclopenten-1-yl]-5-methylthiophen-2-yl]aniline |
| SMILES | Cc1sc(Cl)cc1C1=C(c2cc(-c3ccc(N)cc3)sc2C)CCC1 |
| InChI | InChI=1S/C21H20ClNS2/c1-12-18(10-20(24-12)14-6-8-15(23)9-7-14)16-4-3-5-17(16)19-11-21(22)25-13(19)2/h6-11H,3-5,23H2,1-2H3 |
| InChIKey | IQTSWAXDVPYHKY-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.99 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|