C19H23NO7 — CID 139246790
methyl 7-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]-2-oxochromene-3-carboxylate (PubChem CID 139246790) has the molecular formula C19H23NO7 and a molecular weight of 377.39 g/mol. Its IUPAC name is methyl 7-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]-2-oxochromene-3-carboxylate.
| Compound Name | methyl 7-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]-2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 139246790 |
| Molecular Formula | C19H23NO7 |
| Molecular Weight | 377.39 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | methyl 7-[(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propoxy]-2-oxochromene-3-carboxylate |
| SMILES | COC(=O)c1cc2ccc(OC[C@H](C)NC(=O)OC(C)(C)C)cc2oc1=O |
| InChI | InChI=1S/C19H23NO7/c1-11(20-18(23)27-19(2,3)4)10-25-13-7-6-12-8-14(16(21)24-5)17(22)26-15(12)9-13/h6-9,11H,10H2,1-5H3,(H,20,23)/t11-/m0/s1 |
| InChIKey | FVOORBMQRVRUAS-NSHDSACASA-N |
| XLogP | 2.87 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|