C48H44Br2N4O2 — CID 139247416
4-pyridin-4-yl-1-[4-[1-[2-[4-(4-pyridin-4-ylpyridin-1-ium-1-yl)butoxy]naphthalen-1-yl]naphthalen-2-yl]oxybutyl]pyridin-1-ium dibromide (PubChem CID 139247416) has the molecular formula C48H44Br2N4O2 and a molecular weight of 868.71 g/mol. Its IUPAC name is 4-pyridin-4-yl-1-[4-[1-[2-[4-(4-pyridin-4-ylpyridin-1-ium-1-yl)butoxy]naphthalen-1-yl]naphthalen-2-yl]oxybutyl]pyridin-1-ium dibromide.
| Compound Name | 4-pyridin-4-yl-1-[4-[1-[2-[4-(4-pyridin-4-ylpyridin-1-ium-1-yl)butoxy]naphthalen-1-yl]naphthalen-2-yl]oxybutyl]pyridin-1-ium dibromide |
|---|---|
| PubChem CID | 139247416 |
| Molecular Formula | C48H44Br2N4O2 |
| Molecular Weight | 868.71 g/mol |
| Exact Mass | 866.18 |
| IUPAC Name | 4-pyridin-4-yl-1-[4-[1-[2-[4-(4-pyridin-4-ylpyridin-1-ium-1-yl)butoxy]naphthalen-1-yl]naphthalen-2-yl]oxybutyl]pyridin-1-ium dibromide |
| SMILES | [Br-].[Br-].c1ccc2c(-c3c(OCCCC[n+]4ccc(-c5ccncc5)cc4)ccc4ccccc34)c(OCCCC[n+]3ccc(-c4ccncc4)cc3)ccc2c1 |
| InChI | InChI=1S/C48H44N4O2.2BrH/c1-3-11-43-41(9-1)13-15-45(53-35-7-5-29-51-31-21-39(22-32-51)37-17-25-49-26-18-37)47(43)48-44-12-4-2-10-42(44)14-16-46(48)54-36-8-6-30-52-33-23-40(24-34-52)38-19-27-50-28-20-38;;/h1-4,9-28,31-34H,5-8,29-30,35-36H2;2*1H/q+2;;/p-2 |
| InChIKey | QZXGZNMXINRQRT-UHFFFAOYSA-L |
| XLogP | 4.09 |
| TPSA | 52.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 56 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 868.71 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|