C37H39N3O5 — CID 139247434
methyl (1S,3S)-1-butyl-2-[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate (PubChem CID 139247434) has the molecular formula C37H39N3O5 and a molecular weight of 605.74 g/mol. Its IUPAC name is methyl (1S,3S)-1-butyl-2-[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl (1S,3S)-1-butyl-2-[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 139247434 |
| Molecular Formula | C37H39N3O5 |
| Molecular Weight | 605.74 g/mol |
| Exact Mass | 605.29 |
| IUPAC Name | methyl (1S,3S)-1-butyl-2-[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole-3-carboxylate |
| SMILES | CCCC[C@H]1c2[nH]c3ccccc3c2C[C@@H](C(=O)OC)N1C(=O)[C@@H]1CCCN1C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C37H39N3O5/c1-3-4-18-31-34-28(27-16-9-10-17-30(27)38-34)21-33(36(42)44-2)40(31)35(41)32-19-11-20-39(32)37(43)45-22-29-25-14-7-5-12-23(25)24-13-6-8-15-26(24)29/h5-10,12-17,29,31-33,38H,3-4,11,18-22H2,1-2H3/t31-,32-,33-/m0/s1 |
| InChIKey | LMGJXOLSVBDUTD-ZDCRTTOTSA-N |
| XLogP | 6.74 |
| TPSA | 91.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.74 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|