C20H21N3S — CID 139247963
4-[(R)-[(2R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-isothiocyanatomethyl]quinoline (PubChem CID 139247963) has the molecular formula C20H21N3S and a molecular weight of 335.48 g/mol. Its IUPAC name is 4-[(R)-[(2R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-isothiocyanatomethyl]quinoline.
| Compound Name | 4-[(R)-[(2R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-isothiocyanatomethyl]quinoline |
|---|---|
| PubChem CID | 139247963 |
| Molecular Formula | C20H21N3S |
| Molecular Weight | 335.48 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | 4-[(R)-[(2R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-isothiocyanatomethyl]quinoline |
| SMILES | C=CC1CN2CCC1C[C@@H]2[C@H](N=C=S)c1ccnc2ccccc12 |
| InChI | InChI=1S/C20H21N3S/c1-2-14-12-23-10-8-15(14)11-19(23)20(22-13-24)17-7-9-21-18-6-4-3-5-16(17)18/h2-7,9,14-15,19-20H,1,8,10-12H2/t14?,15?,19-,20-/m1/s1 |
| InChIKey | FDLSXPJDCINANZ-UHHKXXHQSA-N |
| XLogP | 4.28 |
| TPSA | 28.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.48 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|