C4H18N3+ — CID 139248119
azane;N,N-dimethylmethanamine;methylazanium (PubChem CID 139248119) has the molecular formula C4H18N3+ and a molecular weight of 108.21 g/mol. Its IUPAC name is azane;N,N-dimethylmethanamine;methylazanium.
| Compound Name | azane;N,N-dimethylmethanamine;methylazanium |
|---|---|
| PubChem CID | 139248119 |
| Molecular Formula | C4H18N3+ |
| Molecular Weight | 108.21 g/mol |
| Exact Mass | 108.15 |
| IUPAC Name | azane;N,N-dimethylmethanamine;methylazanium |
| SMILES | CN(C)C.C[NH3+].N |
| InChI | InChI=1S/C3H9N.CH5N.H3N/c1-4(2)3;1-2;/h1-3H3;2H2,1H3;1H3/p+1 |
| InChIKey | BVFNIIJAZYUVMJ-UHFFFAOYSA-O |
| XLogP | -0.80 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 108.21 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |