C39H86O5Si3Sn — CID 139249825
(E,5R,7R,8R)-5,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3-tributylstannyl-7-(2-trimethylsilylethoxymethoxy)non-2-en-1-ol (PubChem CID 139249825) has the molecular formula C39H86O5Si3Sn and a molecular weight of 838.08 g/mol. Its IUPAC name is (E,5R,7R,8R)-5,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3-tributylstannyl-7-(2-trimethylsilylethoxymethoxy)non-2-en-1-ol.
| Compound Name | (E,5R,7R,8R)-5,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3-tributylstannyl-7-(2-trimethylsilylethoxymethoxy)non-2-en-1-ol |
|---|---|
| PubChem CID | 139249825 |
| Molecular Formula | C39H86O5Si3Sn |
| Molecular Weight | 838.08 g/mol |
| Exact Mass | 838.48 |
| IUPAC Name | (E,5R,7R,8R)-5,8-bis[[tert-butyl(dimethyl)silyl]oxy]-3-tributylstannyl-7-(2-trimethylsilylethoxymethoxy)non-2-en-1-ol |
| SMILES | CCCC[Sn](CCCC)(CCCC)/C(=C/CO)C[C@@H](C[C@@H](OCOCC[Si](C)(C)C)[C@@H](C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H59O5Si3.3C4H9.Sn/c1-23(31-34(11,12)26(2,3)4)25(30-22-29-19-20-33(8,9)10)21-24(17-15-16-18-28)32-35(13,14)27(5,6)7;3*1-3-4-2;/h16,23-25,28H,17-22H2,1-14H3;3*1,3-4H2,2H3;/t23-,24+,25-;;;;/m1..../s1 |
| InChIKey | NOYQDJLRHRMFNR-WYFKOZGKSA-N |
| XLogP | 12.57 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.08 |
| LogP ≤ 5 | 12.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|