C37H82O6Si4 — CID 25105534
(2E,4S,6R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-4-triethylsilyloxy-6-(2-trimethylsilylethoxymethoxy)-2-[2-tri(propan-2-yl)silyloxyethylidene]octan-1-ol (PubChem CID 25105534) has the molecular formula C37H82O6Si4 and a molecular weight of 735.40 g/mol. Its IUPAC name is (2E,4S,6R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-4-triethylsilyloxy-6-(2-trimethylsilylethoxymethoxy)-2-[2-tri(propan-2-yl)silyloxyethylidene]octan-1-ol.
| Compound Name | (2E,4S,6R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-4-triethylsilyloxy-6-(2-trimethylsilylethoxymethoxy)-2-[2-tri(propan-2-yl)silyloxyethylidene]octan-1-ol |
|---|---|
| PubChem CID | 25105534 |
| Molecular Formula | C37H82O6Si4 |
| Molecular Weight | 735.40 g/mol |
| Exact Mass | 734.52 |
| IUPAC Name | (2E,4S,6R,7R)-7-[tert-butyl(dimethyl)silyl]oxy-4-triethylsilyloxy-6-(2-trimethylsilylethoxymethoxy)-2-[2-tri(propan-2-yl)silyloxyethylidene]octan-1-ol |
| SMILES | CC[Si](CC)(CC)O[C@@H](C/C(=C\CO[Si](C(C)C)(C(C)C)C(C)C)CO)C[C@@H](OCOCC[Si](C)(C)C)[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C37H82O6Si4/c1-19-46(20-2,21-3)43-35(26-34(28-38)22-23-41-47(30(4)5,31(6)7)32(8)9)27-36(40-29-39-24-25-44(14,15)16)33(10)42-45(17,18)37(11,12)13/h22,30-33,35-36,38H,19-21,23-29H2,1-18H3/b34-22+/t33-,35+,36-/m1/s1 |
| InChIKey | HMFFXWTUMZTIJE-VZOQXYQWSA-N |
| XLogP | 11.38 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.40 |
| LogP ≤ 5 | 11.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|