C18H36O5Si — CID 10666257
(E,5R)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methyl-5-(2-trimethylsilylethoxymethoxy)hex-2-en-1-ol (PubChem CID 10666257) has the molecular formula C18H36O5Si and a molecular weight of 360.57 g/mol. Its IUPAC name is (E,5R)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methyl-5-(2-trimethylsilylethoxymethoxy)hex-2-en-1-ol.
| Compound Name | (E,5R)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methyl-5-(2-trimethylsilylethoxymethoxy)hex-2-en-1-ol |
|---|---|
| PubChem CID | 10666257 |
| Molecular Formula | C18H36O5Si |
| Molecular Weight | 360.57 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | (E,5R)-6-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-2-methyl-5-(2-trimethylsilylethoxymethoxy)hex-2-en-1-ol |
| SMILES | C/C(=C\C[C@H](C[C@H]1COC(C)(C)O1)OCOCC[Si](C)(C)C)CO |
| InChI | InChI=1S/C18H36O5Si/c1-15(12-19)7-8-16(11-17-13-22-18(2,3)23-17)21-14-20-9-10-24(4,5)6/h7,16-17,19H,8-14H2,1-6H3/b15-7+/t16-,17+/m1/s1 |
| InChIKey | ORHKVLDESCQFOQ-KUCHOIMBSA-N |
| XLogP | 3.55 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.57 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|