C37H81BrO5Si4 — CID 139249838
[(E,5S,7R,8R)-3-(bromomethyl)-5,8-bis[[tert-butyl(dimethyl)silyl]oxy]-7-(2-trimethylsilylethoxymethoxy)non-2-enoxy]-tri(propan-2-yl)silane (PubChem CID 139249838) has the molecular formula C37H81BrO5Si4 and a molecular weight of 798.30 g/mol. Its IUPAC name is [(E,5S,7R,8R)-3-(bromomethyl)-5,8-bis[[tert-butyl(dimethyl)silyl]oxy]-7-(2-trimethylsilylethoxymethoxy)non-2-enoxy]-tri(propan-2-yl)silane.
| Compound Name | [(E,5S,7R,8R)-3-(bromomethyl)-5,8-bis[[tert-butyl(dimethyl)silyl]oxy]-7-(2-trimethylsilylethoxymethoxy)non-2-enoxy]-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 139249838 |
| Molecular Formula | C37H81BrO5Si4 |
| Molecular Weight | 798.30 g/mol |
| Exact Mass | 796.43 |
| IUPAC Name | [(E,5S,7R,8R)-3-(bromomethyl)-5,8-bis[[tert-butyl(dimethyl)silyl]oxy]-7-(2-trimethylsilylethoxymethoxy)non-2-enoxy]-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](OC/C=C(/CBr)C[C@@H](C[C@@H](OCOCC[Si](C)(C)C)[C@@H](C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C37H81BrO5Si4/c1-29(2)47(30(3)4,31(5)6)41-22-21-33(27-38)25-34(43-46(19,20)37(11,12)13)26-35(40-28-39-23-24-44(14,15)16)32(7)42-45(17,18)36(8,9)10/h21,29-32,34-35H,22-28H2,1-20H3/b33-21+/t32-,34+,35-/m1/s1 |
| InChIKey | JSWRHZWVZLCQGB-BYVCXXBRSA-N |
| XLogP | 12.78 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 798.30 |
| LogP ≤ 5 | 12.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|