C16H22O2 — CID 139250261
(5S)-5-[(4E)-2,6-dimethylhepta-4,6-dien-2-yl]-3-ethenyl-5-methylfuran-2-one (PubChem CID 139250261) has the molecular formula C16H22O2 and a molecular weight of 246.35 g/mol. Its IUPAC name is (5S)-5-[(4E)-2,6-dimethylhepta-4,6-dien-2-yl]-3-ethenyl-5-methylfuran-2-one.
| Compound Name | (5S)-5-[(4E)-2,6-dimethylhepta-4,6-dien-2-yl]-3-ethenyl-5-methylfuran-2-one |
|---|---|
| PubChem CID | 139250261 |
| Molecular Formula | C16H22O2 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | (5S)-5-[(4E)-2,6-dimethylhepta-4,6-dien-2-yl]-3-ethenyl-5-methylfuran-2-one |
| SMILES | C=CC1=C[C@@](C)(C(C)(C)C/C=C/C(=C)C)OC1=O |
| InChI | InChI=1S/C16H22O2/c1-7-13-11-16(6,18-14(13)17)15(4,5)10-8-9-12(2)3/h7-9,11H,1-2,10H2,3-6H3/b9-8+/t16-/m0/s1 |
| InChIKey | QLSCNYLUUMLPJM-FDMDGMSGSA-N |
| XLogP | 3.96 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|