C25H22P+ — CID 139250642
(4-methylphenyl)-tris(2,3,4,5,6-pentadeuteriophenyl)phosphanium (PubChem CID 139250642) has the molecular formula C25H22P+ and a molecular weight of 368.52 g/mol. Its IUPAC name is (4-methylphenyl)-tris(2,3,4,5,6-pentadeuteriophenyl)phosphanium.
| Compound Name | (4-methylphenyl)-tris(2,3,4,5,6-pentadeuteriophenyl)phosphanium |
|---|---|
| PubChem CID | 139250642 |
| Molecular Formula | C25H22P+ |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | (4-methylphenyl)-tris(2,3,4,5,6-pentadeuteriophenyl)phosphanium |
| SMILES | [2H]c1c([2H])c([2H])c([P+](c2ccc(C)cc2)(c2c([2H])c([2H])c([2H])c([2H])c2[2H])c2c([2H])c([2H])c([2H])c([2H])c2[2H])c([2H])c1[2H] |
| InChI | InChI=1S/C25H22P/c1-21-17-19-25(20-18-21)26(22-11-5-2-6-12-22,23-13-7-3-8-14-23)24-15-9-4-10-16-24/h2-20H,1H3/q+1/i2D,3D,4D,5D,6D,7D,8D,9D,10D,11D,12D,13D,14D,15D,16D |
| InChIKey | PQCPZAYVYWOSIA-GMGQRHSFSA-N |
| XLogP | 4.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|