C23H29NOSi — CID 139252452
[1]benzofuro[2,3-b]indol-6-yl-tri(propan-2-yl)silane (PubChem CID 139252452) has the molecular formula C23H29NOSi and a molecular weight of 363.58 g/mol. Its IUPAC name is [1]benzofuro[2,3-b]indol-6-yl-tri(propan-2-yl)silane.
| Compound Name | [1]benzofuro[2,3-b]indol-6-yl-tri(propan-2-yl)silane |
|---|---|
| PubChem CID | 139252452 |
| Molecular Formula | C23H29NOSi |
| Molecular Weight | 363.58 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | [1]benzofuro[2,3-b]indol-6-yl-tri(propan-2-yl)silane |
| SMILES | CC(C)[Si](C(C)C)(C(C)C)n1c2ccccc2c2c3ccccc3oc21 |
| InChI | InChI=1S/C23H29NOSi/c1-15(2)26(16(3)4,17(5)6)24-20-13-9-7-11-18(20)22-19-12-8-10-14-21(19)25-23(22)24/h7-17H,1-6H3 |
| InChIKey | FPYPJCOGVJBOBN-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 18.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.58 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|