C15H15NO — CID 71723800
3,4-diethyl-[1]benzofuro[2,3-c]pyridine (PubChem CID 71723800) has the molecular formula C15H15NO and a molecular weight of 225.29 g/mol. Its IUPAC name is 3,4-diethyl-[1]benzofuro[2,3-c]pyridine.
| Compound Name | 3,4-diethyl-[1]benzofuro[2,3-c]pyridine |
|---|---|
| PubChem CID | 71723800 |
| Molecular Formula | C15H15NO |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | 3,4-diethyl-[1]benzofuro[2,3-c]pyridine |
| SMILES | CCc1ncc2oc3ccccc3c2c1CC |
| InChI | InChI=1S/C15H15NO/c1-3-10-12(4-2)16-9-14-15(10)11-7-5-6-8-13(11)17-14/h5-9H,3-4H2,1-2H3 |
| InChIKey | LHRRCUPNHZBWIA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |