C30H41F3O4Si — CID 139252499
[(2E,6S,8Z,11Z)-1-[tert-butyl(dimethyl)silyl]oxytetradeca-2,8,11-trien-4-yn-6-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 139252499) has the molecular formula C30H41F3O4Si and a molecular weight of 550.73 g/mol. Its IUPAC name is [(2E,6S,8Z,11Z)-1-[tert-butyl(dimethyl)silyl]oxytetradeca-2,8,11-trien-4-yn-6-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(2E,6S,8Z,11Z)-1-[tert-butyl(dimethyl)silyl]oxytetradeca-2,8,11-trien-4-yn-6-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 139252499 |
| Molecular Formula | C30H41F3O4Si |
| Molecular Weight | 550.73 g/mol |
| Exact Mass | 550.27 |
| IUPAC Name | [(2E,6S,8Z,11Z)-1-[tert-butyl(dimethyl)silyl]oxytetradeca-2,8,11-trien-4-yn-6-yl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CC/C=C\C/C=C\C[C@@H](C#C/C=C/CO[Si](C)(C)C(C)(C)C)OC(=O)[C@@](OC)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C30H41F3O4Si/c1-8-9-10-11-12-17-22-26(23-18-14-19-24-36-38(6,7)28(2,3)4)37-27(34)29(35-5,30(31,32)33)25-20-15-13-16-21-25/h9-10,12-17,19-21,26H,8,11,22,24H2,1-7H3/b10-9-,17-12-,19-14+/t26-,29-/m0/s1 |
| InChIKey | YNTPSOBLPFIGLJ-OUIVENCPSA-N |
| XLogP | 7.89 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.73 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|