C16H23F3O3Si — CID 24763925
tert-butyl (2R)-3,3,3-trifluoro-2-phenyl-2-trimethylsilyloxypropanoate (PubChem CID 24763925) has the molecular formula C16H23F3O3Si and a molecular weight of 348.44 g/mol. Its IUPAC name is tert-butyl (2R)-3,3,3-trifluoro-2-phenyl-2-trimethylsilyloxypropanoate.
| Compound Name | tert-butyl (2R)-3,3,3-trifluoro-2-phenyl-2-trimethylsilyloxypropanoate |
|---|---|
| PubChem CID | 24763925 |
| Molecular Formula | C16H23F3O3Si |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.14 |
| IUPAC Name | tert-butyl (2R)-3,3,3-trifluoro-2-phenyl-2-trimethylsilyloxypropanoate |
| SMILES | CC(C)(C)OC(=O)[C@](O[Si](C)(C)C)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C16H23F3O3Si/c1-14(2,3)21-13(20)15(16(17,18)19,22-23(4,5)6)12-10-8-7-9-11-12/h7-11H,1-6H3/t15-/m1/s1 |
| InChIKey | YHFDUOGVZYRIRG-OAHLLOKOSA-N |
| XLogP | 4.64 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|