C64H43N5OZn — CID 139253228
zinc 4-pyren-1-yl-N-[4-(10,15,20-triphenylporphyrin-22,24-diid-5-yl)phenyl]butanamide (PubChem CID 139253228) has the molecular formula C64H43N5OZn and a molecular weight of 963.47 g/mol. Its IUPAC name is zinc 4-pyren-1-yl-N-[4-(10,15,20-triphenylporphyrin-22,24-diid-5-yl)phenyl]butanamide.
| Compound Name | zinc 4-pyren-1-yl-N-[4-(10,15,20-triphenylporphyrin-22,24-diid-5-yl)phenyl]butanamide |
|---|---|
| PubChem CID | 139253228 |
| Molecular Formula | C64H43N5OZn |
| Molecular Weight | 963.47 g/mol |
| Exact Mass | 961.28 |
| IUPAC Name | zinc 4-pyren-1-yl-N-[4-(10,15,20-triphenylporphyrin-22,24-diid-5-yl)phenyl]butanamide |
| SMILES | O=C(CCCc1ccc2ccc3cccc4ccc1c2c34)Nc1ccc(-c2c3nc(c(-c4ccccc4)c4ccc([n-]4)c(-c4ccccc4)c4nc(c(-c5ccccc5)c5ccc2[n-]5)C=C4)C=C3)cc1.[Zn+2] |
| InChI | InChI=1S/C64H44N5O.Zn/c70-58(21-11-18-40-22-23-46-25-24-44-19-10-20-45-28-31-49(40)60(46)59(44)45)65-48-29-26-47(27-30-48)64-56-38-36-54(68-56)62(42-14-6-2-7-15-42)52-34-32-50(66-52)61(41-12-4-1-5-13-41)51-33-35-53(67-51)63(43-16-8-3-9-17-43)55-37-39-57(64)69-55;/h1-10,12-17,19-20,22-39H,11,18,21H2,(H2-,65,66,67,68,69,70);/q-1;+2/p-1/b61-50-,61-51-,62-52-,62-54-,63-53-,63-55-,64-56-,64-57-; |
| InChIKey | MYSVEDIGAHJWRN-VYKNZAOYSA-M |
| XLogP | 15.44 |
| TPSA | 83.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 963.47 |
| LogP ≤ 5 | 15.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|