C45H45NS3Si3 — CID 139253878
4-[5-(2-trimethylsilylethynyl)thiophen-2-yl]-N,N-bis[4-[5-(2-trimethylsilylethynyl)thiophen-2-yl]phenyl]aniline (PubChem CID 139253878) has the molecular formula C45H45NS3Si3 and a molecular weight of 780.32 g/mol. Its IUPAC name is 4-[5-(2-trimethylsilylethynyl)thiophen-2-yl]-N,N-bis[4-[5-(2-trimethylsilylethynyl)thiophen-2-yl]phenyl]aniline.
| Compound Name | 4-[5-(2-trimethylsilylethynyl)thiophen-2-yl]-N,N-bis[4-[5-(2-trimethylsilylethynyl)thiophen-2-yl]phenyl]aniline |
|---|---|
| PubChem CID | 139253878 |
| Molecular Formula | C45H45NS3Si3 |
| Molecular Weight | 780.32 g/mol |
| Exact Mass | 779.20 |
| IUPAC Name | 4-[5-(2-trimethylsilylethynyl)thiophen-2-yl]-N,N-bis[4-[5-(2-trimethylsilylethynyl)thiophen-2-yl]phenyl]aniline |
| SMILES | C[Si](C)(C)C#Cc1ccc(-c2ccc(N(c3ccc(-c4ccc(C#C[Si](C)(C)C)s4)cc3)c3ccc(-c4ccc(C#C[Si](C)(C)C)s4)cc3)cc2)s1 |
| InChI | InChI=1S/C45H45NS3Si3/c1-50(2,3)31-28-40-22-25-43(47-40)34-10-16-37(17-11-34)46(38-18-12-35(13-19-38)44-26-23-41(48-44)29-32-51(4,5)6)39-20-14-36(15-21-39)45-27-24-42(49-45)30-33-52(7,8)9/h10-27H,1-9H3 |
| InChIKey | QGHLBUOTXKFJLJ-UHFFFAOYSA-N |
| XLogP | 14.03 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 780.32 |
| LogP ≤ 5 | 14.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|