C38H48N2S2 — CID 102315349
N,N-dibutyl-4-[5-[2-[5-[4-(dibutylamino)phenyl]thiophen-2-yl]ethynyl]thiophen-2-yl]aniline (PubChem CID 102315349) has the molecular formula C38H48N2S2 and a molecular weight of 596.95 g/mol. Its IUPAC name is N,N-dibutyl-4-[5-[2-[5-[4-(dibutylamino)phenyl]thiophen-2-yl]ethynyl]thiophen-2-yl]aniline.
| Compound Name | N,N-dibutyl-4-[5-[2-[5-[4-(dibutylamino)phenyl]thiophen-2-yl]ethynyl]thiophen-2-yl]aniline |
|---|---|
| PubChem CID | 102315349 |
| Molecular Formula | C38H48N2S2 |
| Molecular Weight | 596.95 g/mol |
| Exact Mass | 596.33 |
| IUPAC Name | N,N-dibutyl-4-[5-[2-[5-[4-(dibutylamino)phenyl]thiophen-2-yl]ethynyl]thiophen-2-yl]aniline |
| SMILES | CCCCN(CCCC)c1ccc(-c2ccc(C#Cc3ccc(-c4ccc(N(CCCC)CCCC)cc4)s3)s2)cc1 |
| InChI | InChI=1S/C38H48N2S2/c1-5-9-27-39(28-10-6-2)33-17-13-31(14-18-33)37-25-23-35(41-37)21-22-36-24-26-38(42-36)32-15-19-34(20-16-32)40(29-11-7-3)30-12-8-4/h13-20,23-26H,5-12,27-30H2,1-4H3 |
| InChIKey | BOVPOWMUFZVJIO-UHFFFAOYSA-N |
| XLogP | 11.36 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.95 |
| LogP ≤ 5 | 11.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|