C82H101N4OPS4 — CID 102315348
N,N-dibutyl-4-[5-[2,4,5-tris[5-[4-(dibutylamino)phenyl]thiophen-2-yl]-1-oxo-1-phenyl-1λ5-phosphol-3-yl]thiophen-2-yl]aniline (PubChem CID 102315348) has the molecular formula C82H101N4OPS4 and a molecular weight of 1317.98 g/mol. Its IUPAC name is N,N-dibutyl-4-[5-[2,4,5-tris[5-[4-(dibutylamino)phenyl]thiophen-2-yl]-1-oxo-1-phenyl-1λ5-phosphol-3-yl]thiophen-2-yl]aniline.
| Compound Name | N,N-dibutyl-4-[5-[2,4,5-tris[5-[4-(dibutylamino)phenyl]thiophen-2-yl]-1-oxo-1-phenyl-1λ5-phosphol-3-yl]thiophen-2-yl]aniline |
|---|---|
| PubChem CID | 102315348 |
| Molecular Formula | C82H101N4OPS4 |
| Molecular Weight | 1317.98 g/mol |
| Exact Mass | 1316.66 |
| IUPAC Name | N,N-dibutyl-4-[5-[2,4,5-tris[5-[4-(dibutylamino)phenyl]thiophen-2-yl]-1-oxo-1-phenyl-1λ5-phosphol-3-yl]thiophen-2-yl]aniline |
| SMILES | CCCCN(CCCC)c1ccc(-c2ccc(C3=C(c4ccc(-c5ccc(N(CCCC)CCCC)cc5)s4)P(=O)(c4ccccc4)C(c4ccc(-c5ccc(N(CCCC)CCCC)cc5)s4)=C3c3ccc(-c4ccc(N(CCCC)CCCC)cc4)s3)s2)cc1 |
| InChI | InChI=1S/C82H101N4OPS4/c1-9-17-54-83(55-18-10-2)66-38-30-62(31-39-66)71-46-50-75(89-71)79-80(76-51-47-72(90-76)63-32-40-67(41-33-63)84(56-19-11-3)57-20-12-4)82(78-53-49-74(92-78)65-36-44-69(45-37-65)86(60-23-15-7)61-24-16-8)88(87,70-28-26-25-27-29-70)81(79)77-52-48-73(91-77)64-34-42-68(43-35-64)85(58-21-13-5)59-22-14-6/h25-53H,9-24,54-61H2,1-8H3 |
| InChIKey | NEYJSPNNXRDSCJ-UHFFFAOYSA-N |
| XLogP | 25.37 |
| TPSA | 30.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 92 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1317.98 |
| LogP ≤ 5 | 25.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|