C21H38O2 — CID 139254519
1-[(1S,3R)-2,2-dimethyl-3-(2-oxoheptyl)cyclobutyl]-5,5-dimethylhexan-2-one (PubChem CID 139254519) has the molecular formula C21H38O2 and a molecular weight of 322.53 g/mol. Its IUPAC name is 1-[(1S,3R)-2,2-dimethyl-3-(2-oxoheptyl)cyclobutyl]-5,5-dimethylhexan-2-one.
| Compound Name | 1-[(1S,3R)-2,2-dimethyl-3-(2-oxoheptyl)cyclobutyl]-5,5-dimethylhexan-2-one |
|---|---|
| PubChem CID | 139254519 |
| Molecular Formula | C21H38O2 |
| Molecular Weight | 322.53 g/mol |
| Exact Mass | 322.29 |
| IUPAC Name | 1-[(1S,3R)-2,2-dimethyl-3-(2-oxoheptyl)cyclobutyl]-5,5-dimethylhexan-2-one |
| SMILES | CCCCCC(=O)C[C@H]1C[C@@H](CC(=O)CCC(C)(C)C)C1(C)C |
| InChI | InChI=1S/C21H38O2/c1-7-8-9-10-18(22)14-16-13-17(21(16,5)6)15-19(23)11-12-20(2,3)4/h16-17H,7-15H2,1-6H3/t16-,17+/m1/s1 |
| InChIKey | FNJHXUODWOKIEI-SJORKVTESA-N |
| XLogP | 5.97 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.53 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|