C12H20O2 — CID 139255196
(1R,3aR,6R,8aR)-1-hydroxy-1,6-dimethyl-2,3,3a,5,6,7,8,8a-octahydroazulen-4-one (PubChem CID 139255196) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is (1R,3aR,6R,8aR)-1-hydroxy-1,6-dimethyl-2,3,3a,5,6,7,8,8a-octahydroazulen-4-one.
| Compound Name | (1R,3aR,6R,8aR)-1-hydroxy-1,6-dimethyl-2,3,3a,5,6,7,8,8a-octahydroazulen-4-one |
|---|---|
| PubChem CID | 139255196 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | (1R,3aR,6R,8aR)-1-hydroxy-1,6-dimethyl-2,3,3a,5,6,7,8,8a-octahydroazulen-4-one |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](CC[C@@]2(C)O)C(=O)C1 |
| InChI | InChI=1S/C12H20O2/c1-8-3-4-10-9(11(13)7-8)5-6-12(10,2)14/h8-10,14H,3-7H2,1-2H3/t8-,9-,10-,12-/m1/s1 |
| InChIKey | XWLLYMRVKFJMOK-DNRKLUKYSA-N |
| XLogP | 2.15 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |