C16H21BrFNO — CID 139256998
(Z)-3-(3-bromo-5-fluorophenyl)-2-methyl-N,N-di(propan-2-yl)prop-2-enamide (PubChem CID 139256998) has the molecular formula C16H21BrFNO and a molecular weight of 342.25 g/mol. Its IUPAC name is (Z)-3-(3-bromo-5-fluorophenyl)-2-methyl-N,N-di(propan-2-yl)prop-2-enamide.
| Compound Name | (Z)-3-(3-bromo-5-fluorophenyl)-2-methyl-N,N-di(propan-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 139256998 |
| Molecular Formula | C16H21BrFNO |
| Molecular Weight | 342.25 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | (Z)-3-(3-bromo-5-fluorophenyl)-2-methyl-N,N-di(propan-2-yl)prop-2-enamide |
| SMILES | C/C(=C/c1cc(F)cc(Br)c1)C(=O)N(C(C)C)C(C)C |
| InChI | InChI=1S/C16H21BrFNO/c1-10(2)19(11(3)4)16(20)12(5)6-13-7-14(17)9-15(18)8-13/h6-11H,1-5H3/b12-6- |
| InChIKey | SUHJJVANXDGRIT-SDQBBNPISA-N |
| XLogP | 4.64 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.25 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|