C40H34O2Si — CID 139257273
2-[4-[2-(2,5-dimethoxyphenyl)ethynyl]phenyl]-1,1-dimethyl-3,4,5-triphenylsilole (PubChem CID 139257273) has the molecular formula C40H34O2Si and a molecular weight of 574.80 g/mol. Its IUPAC name is 2-[4-[2-(2,5-dimethoxyphenyl)ethynyl]phenyl]-1,1-dimethyl-3,4,5-triphenylsilole.
| Compound Name | 2-[4-[2-(2,5-dimethoxyphenyl)ethynyl]phenyl]-1,1-dimethyl-3,4,5-triphenylsilole |
|---|---|
| PubChem CID | 139257273 |
| Molecular Formula | C40H34O2Si |
| Molecular Weight | 574.80 g/mol |
| Exact Mass | 574.23 |
| IUPAC Name | 2-[4-[2-(2,5-dimethoxyphenyl)ethynyl]phenyl]-1,1-dimethyl-3,4,5-triphenylsilole |
| SMILES | COc1ccc(OC)c(C#Cc2ccc(C3=C(c4ccccc4)C(c4ccccc4)=C(c4ccccc4)[Si]3(C)C)cc2)c1 |
| InChI | InChI=1S/C40H34O2Si/c1-41-35-26-27-36(42-2)34(28-35)25-22-29-20-23-33(24-21-29)40-38(31-16-10-6-11-17-31)37(30-14-8-5-9-15-30)39(43(40,3)4)32-18-12-7-13-19-32/h5-21,23-24,26-28H,1-4H3 |
| InChIKey | KENRPRXJHPHOQG-UHFFFAOYSA-N |
| XLogP | 9.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.80 |
| LogP ≤ 5 | 9.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|