C18H21NO5 — CID 139258169
ethyl (1R,5S,6S,9S)-10-oxo-9-phenyl-7,11-dioxa-8-azatricyclo[6.4.0.01,5]dodecane-6-carboxylate (PubChem CID 139258169) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is ethyl (1R,5S,6S,9S)-10-oxo-9-phenyl-7,11-dioxa-8-azatricyclo[6.4.0.01,5]dodecane-6-carboxylate.
| Compound Name | ethyl (1R,5S,6S,9S)-10-oxo-9-phenyl-7,11-dioxa-8-azatricyclo[6.4.0.01,5]dodecane-6-carboxylate |
|---|---|
| PubChem CID | 139258169 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | ethyl (1R,5S,6S,9S)-10-oxo-9-phenyl-7,11-dioxa-8-azatricyclo[6.4.0.01,5]dodecane-6-carboxylate |
| SMILES | CCOC(=O)[C@H]1ON2[C@@H](c3ccccc3)C(=O)OC[C@]23CCC[C@H]13 |
| InChI | InChI=1S/C18H21NO5/c1-2-22-17(21)15-13-9-6-10-18(13)11-23-16(20)14(19(18)24-15)12-7-4-3-5-8-12/h3-5,7-8,13-15H,2,6,9-11H2,1H3/t13-,14+,15+,18+/m1/s1 |
| InChIKey | FBCILIGOZUCKJT-LLDVTBCESA-N |
| XLogP | 2.00 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |