C16H28O4Si — CID 139261292
(2R,6Z,8S)-8-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3,4,8,9-tetrahydro-2H-oxecine-5,10-dione (PubChem CID 139261292) has the molecular formula C16H28O4Si and a molecular weight of 312.48 g/mol. Its IUPAC name is (2R,6Z,8S)-8-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3,4,8,9-tetrahydro-2H-oxecine-5,10-dione.
| Compound Name | (2R,6Z,8S)-8-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3,4,8,9-tetrahydro-2H-oxecine-5,10-dione |
|---|---|
| PubChem CID | 139261292 |
| Molecular Formula | C16H28O4Si |
| Molecular Weight | 312.48 g/mol |
| Exact Mass | 312.18 |
| IUPAC Name | (2R,6Z,8S)-8-[tert-butyl(dimethyl)silyl]oxy-2-methyl-3,4,8,9-tetrahydro-2H-oxecine-5,10-dione |
| SMILES | C[C@@H]1CCC(=O)/C=C\[C@@H](O[Si](C)(C)C(C)(C)C)CC(=O)O1 |
| InChI | InChI=1S/C16H28O4Si/c1-12-7-8-13(17)9-10-14(11-15(18)19-12)20-21(5,6)16(2,3)4/h9-10,12,14H,7-8,11H2,1-6H3/b10-9-/t12-,14-/m1/s1 |
| InChIKey | VQQIGQAJYHTMQE-YJCXCIGHSA-N |
| XLogP | 3.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.48 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|