C20H36O4Si — CID 57327645
ethyl (4E,6E,11R)-11-[tert-butyl(dimethyl)silyl]oxy-3-oxododeca-4,6-dienoate (PubChem CID 57327645) has the molecular formula C20H36O4Si and a molecular weight of 368.59 g/mol. Its IUPAC name is ethyl (4E,6E,11R)-11-[tert-butyl(dimethyl)silyl]oxy-3-oxododeca-4,6-dienoate.
| Compound Name | ethyl (4E,6E,11R)-11-[tert-butyl(dimethyl)silyl]oxy-3-oxododeca-4,6-dienoate |
|---|---|
| PubChem CID | 57327645 |
| Molecular Formula | C20H36O4Si |
| Molecular Weight | 368.59 g/mol |
| Exact Mass | 368.24 |
| IUPAC Name | ethyl (4E,6E,11R)-11-[tert-butyl(dimethyl)silyl]oxy-3-oxododeca-4,6-dienoate |
| SMILES | CCOC(=O)CC(=O)/C=C/C=C/CCC[C@@H](C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H36O4Si/c1-8-23-19(22)16-18(21)15-13-11-9-10-12-14-17(2)24-25(6,7)20(3,4)5/h9,11,13,15,17H,8,10,12,14,16H2,1-7H3/b11-9+,15-13+/t17-/m1/s1 |
| InChIKey | GLGZWYFHUWRISS-BHQQVJJRSA-N |
| XLogP | 5.20 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.59 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|