About 6-(5-oxo-3-trimethylsilyloxycyclopenten-1-yl)hex-5-enyl trimethylsilylformate
6-(5-oxo-3-trimethylsilyloxycyclopenten-1-yl)hex-5-enyl trimethylsilylformate (PubChem CID 57060135) has the molecular formula C18H32O4Si2
and a molecular weight of 368.62 g/mol. Its IUPAC name is 6-(5-oxo-3-trimethylsilyloxycyclopenten-1-yl)hex-5-enyl trimethylsilylformate.
Molecular Properties
| Compound Name | 6-(5-oxo-3-trimethylsilyloxycyclopenten-1-yl)hex-5-enyl trimethylsilylformate |
| PubChem CID | 57060135 |
| Molecular Formula | C18H32O4Si2 |
| Molecular Weight | 368.62 g/mol |
| Exact Mass | 368.18 |
| IUPAC Name | 6-(5-oxo-3-trimethylsilyloxycyclopenten-1-yl)hex-5-enyl trimethylsilylformate |
| SMILES | C[Si](C)(C)OC1C=C(C=CCCCCOC(=O)[Si](C)(C)C)C(=O)C1 |
| InChI | InChI=1S/C18H32O4Si2/c1-23(2,3)18(20)21-12-10-8-7-9-11-15-13-16(14-17(15)19)22-24(4,5)6/h9,11,13,16H,7-8,10,12,14H2,1-6H3 |
| InChIKey | UROZJVSDYMXUPL-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.62 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 6-(5-oxo-3-trimethylsilyloxycyclopenten-1-yl)hex-5-enyl trimethylsilylformate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(5-oxo-3-trimethylsilyloxycyclopenten-1-yl)hex-5-enyl trimethylsilylformate?
The IUPAC name of 6-(5-oxo-3-trimethylsilyloxycyclopenten-1-yl)hex-5-enyl trimethylsilylformate (CID 57060135) is 6-(5-oxo-3-trimethylsilyloxycyclopenten-1-yl)hex-5-enyl trimethylsilylformate.
What is the SMILES notation for 6-(5-oxo-3-trimethylsilyloxycyclopenten-1-yl)hex-5-enyl trimethylsilylformate?
The canonical SMILES for 6-(5-oxo-3-trimethylsilyloxycyclopenten-1-yl)hex-5-enyl trimethylsilylformate is C[Si](C)(C)OC1C=C(C=CCCCCOC(=O)[Si](C)(C)C)C(=O)C1.
What is the InChIKey of 6-(5-oxo-3-trimethylsilyloxycyclopenten-1-yl)hex-5-enyl trimethylsilylformate?
The InChIKey is UROZJVSDYMXUPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H32O4Si2/c1-23(2,3)18(20)21-12-10-8-7-9-11-15-13-16(14-17(15)19)22-24(4,5)6/h9,11,13,16H,7-8,10,12,14H2,1-6H3.
What are the key properties of 6-(5-oxo-3-trimethylsilyloxycyclopenten-1-yl)hex-5-enyl trimethylsilylformate?
6-(5-oxo-3-trimethylsilyloxycyclopenten-1-yl)hex-5-enyl trimethylsilylformate has a molecular weight of 368.62 g/mol, XLogP of 4.89, 9 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(5-oxo-3-trimethylsilyloxycyclopenten-1-yl)hex-5-enyl trimethylsilylformate is sourced from PubChem (CID 57060135), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).