C22H38O4Si — CID 139710038
butyl (Z)-7-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-oxocyclopenten-1-yl]hept-6-enoate (PubChem CID 139710038) has the molecular formula C22H38O4Si and a molecular weight of 394.63 g/mol. Its IUPAC name is butyl (Z)-7-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-oxocyclopenten-1-yl]hept-6-enoate.
| Compound Name | butyl (Z)-7-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-oxocyclopenten-1-yl]hept-6-enoate |
|---|---|
| PubChem CID | 139710038 |
| Molecular Formula | C22H38O4Si |
| Molecular Weight | 394.63 g/mol |
| Exact Mass | 394.25 |
| IUPAC Name | butyl (Z)-7-[(3R)-3-[tert-butyl(dimethyl)silyl]oxy-5-oxocyclopenten-1-yl]hept-6-enoate |
| SMILES | CCCCOC(=O)CCCC/C=C\C1=C[C@H](O[Si](C)(C)C(C)(C)C)CC1=O |
| InChI | InChI=1S/C22H38O4Si/c1-7-8-15-25-21(24)14-12-10-9-11-13-18-16-19(17-20(18)23)26-27(5,6)22(2,3)4/h11,13,16,19H,7-10,12,14-15,17H2,1-6H3/b13-11-/t19-/m0/s1 |
| InChIKey | VNUZELBJMSHGGS-QXFGJRORSA-N |
| XLogP | 5.74 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.63 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|