C23H42O4Si — CID 134924492
ethyl (4E,6E)-6-methyl-3-oxo-8-[tri(propan-2-yl)silyloxymethyl]deca-4,6-dienoate (PubChem CID 134924492) has the molecular formula C23H42O4Si and a molecular weight of 410.67 g/mol. Its IUPAC name is ethyl (4E,6E)-6-methyl-3-oxo-8-[tri(propan-2-yl)silyloxymethyl]deca-4,6-dienoate.
| Compound Name | ethyl (4E,6E)-6-methyl-3-oxo-8-[tri(propan-2-yl)silyloxymethyl]deca-4,6-dienoate |
|---|---|
| PubChem CID | 134924492 |
| Molecular Formula | C23H42O4Si |
| Molecular Weight | 410.67 g/mol |
| Exact Mass | 410.29 |
| IUPAC Name | ethyl (4E,6E)-6-methyl-3-oxo-8-[tri(propan-2-yl)silyloxymethyl]deca-4,6-dienoate |
| SMILES | CCOC(=O)CC(=O)/C=C/C(C)=C/C(CC)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H42O4Si/c1-10-21(16-27-28(17(3)4,18(5)6)19(7)8)14-20(9)12-13-22(24)15-23(25)26-11-2/h12-14,17-19,21H,10-11,15-16H2,1-9H3/b13-12+,20-14+ |
| InChIKey | KGTBNNGPDHFFNA-VIWRHKKTSA-N |
| XLogP | 6.23 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.67 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|