C23H44O5Si — CID 11846594
ethyl (Z,5R,8R)-5-hydroxy-6-methyl-3-oxo-8-[tri(propan-2-yl)silyloxymethyl]dec-6-enoate (PubChem CID 11846594) has the molecular formula C23H44O5Si and a molecular weight of 428.69 g/mol. Its IUPAC name is ethyl (Z,5R,8R)-5-hydroxy-6-methyl-3-oxo-8-[tri(propan-2-yl)silyloxymethyl]dec-6-enoate.
| Compound Name | ethyl (Z,5R,8R)-5-hydroxy-6-methyl-3-oxo-8-[tri(propan-2-yl)silyloxymethyl]dec-6-enoate |
|---|---|
| PubChem CID | 11846594 |
| Molecular Formula | C23H44O5Si |
| Molecular Weight | 428.69 g/mol |
| Exact Mass | 428.30 |
| IUPAC Name | ethyl (Z,5R,8R)-5-hydroxy-6-methyl-3-oxo-8-[tri(propan-2-yl)silyloxymethyl]dec-6-enoate |
| SMILES | CCOC(=O)CC(=O)C[C@@H](O)/C(C)=C\[C@@H](CC)CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C23H44O5Si/c1-10-20(15-28-29(16(3)4,17(5)6)18(7)8)12-19(9)22(25)13-21(24)14-23(26)27-11-2/h12,16-18,20,22,25H,10-11,13-15H2,1-9H3/b19-12-/t20-,22-/m1/s1 |
| InChIKey | HABVLKDQJIVPBG-GXAKAIMPSA-N |
| XLogP | 5.42 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.69 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|