C50H36N4O4Zn — CID 139261967
zinc methyl 4-[10-(4-methoxycarbonylphenyl)-15,20-bis(4-methylphenyl)porphyrin-21,23-diid-5-yl]benzoate (PubChem CID 139261967) has the molecular formula C50H36N4O4Zn and a molecular weight of 822.25 g/mol. Its IUPAC name is zinc methyl 4-[10-(4-methoxycarbonylphenyl)-15,20-bis(4-methylphenyl)porphyrin-21,23-diid-5-yl]benzoate.
| Compound Name | zinc methyl 4-[10-(4-methoxycarbonylphenyl)-15,20-bis(4-methylphenyl)porphyrin-21,23-diid-5-yl]benzoate |
|---|---|
| PubChem CID | 139261967 |
| Molecular Formula | C50H36N4O4Zn |
| Molecular Weight | 822.25 g/mol |
| Exact Mass | 820.20 |
| IUPAC Name | zinc methyl 4-[10-(4-methoxycarbonylphenyl)-15,20-bis(4-methylphenyl)porphyrin-21,23-diid-5-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2c3nc(c(-c4ccc(C(=O)OC)cc4)c4ccc([n-]4)c(-c4ccc(C)cc4)c4nc(c(-c5ccc(C)cc5)c5ccc2[n-]5)C=C4)C=C3)cc1.[Zn+2] |
| InChI | InChI=1S/C50H37N4O4.Zn/c1-29-5-9-31(10-6-29)45-37-21-22-38(51-37)46(32-11-7-30(2)8-12-32)40-24-26-42(53-40)48(34-15-19-36(20-16-34)50(56)58-4)44-28-27-43(54-44)47(41-25-23-39(45)52-41)33-13-17-35(18-14-33)49(55)57-3;/h5-28H,1-4H3,(H-,51,52,53,54,55,56);/q-1;+2/p-1/b45-37-,45-39-,46-38-,46-40-,47-41-,47-43-,48-42-,48-44-; |
| InChIKey | PDUHVIFLKGATKM-QUEIEKNASA-M |
| XLogP | 10.77 |
| TPSA | 106.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 822.25 |
| LogP ≤ 5 | 10.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|