C81H99N3O4S2 — CID 139262067
5,6-bis[5-[2,2-bis(4-octoxyphenyl)ethenyl]thiophen-2-yl]-1-(4-methyl-2-pyridinyl)benzimidazole (PubChem CID 139262067) has the molecular formula C81H99N3O4S2 and a molecular weight of 1242.83 g/mol. Its IUPAC name is 5,6-bis[5-[2,2-bis(4-octoxyphenyl)ethenyl]thiophen-2-yl]-1-(4-methyl-2-pyridinyl)benzimidazole.
| Compound Name | 5,6-bis[5-[2,2-bis(4-octoxyphenyl)ethenyl]thiophen-2-yl]-1-(4-methyl-2-pyridinyl)benzimidazole |
|---|---|
| PubChem CID | 139262067 |
| Molecular Formula | C81H99N3O4S2 |
| Molecular Weight | 1242.83 g/mol |
| Exact Mass | 1241.71 |
| IUPAC Name | 5,6-bis[5-[2,2-bis(4-octoxyphenyl)ethenyl]thiophen-2-yl]-1-(4-methyl-2-pyridinyl)benzimidazole |
| SMILES | CCCCCCCCOc1ccc(C(=Cc2ccc(-c3cc4ncn(-c5cc(C)ccn5)c4cc3-c3ccc(C=C(c4ccc(OCCCCCCCC)cc4)c4ccc(OCCCCCCCC)cc4)s3)s2)c2ccc(OCCCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C81H99N3O4S2/c1-6-10-14-18-22-26-52-85-67-38-30-63(31-39-67)73(64-32-40-68(41-33-64)86-53-27-23-19-15-11-7-2)57-71-46-48-79(89-71)75-59-77-78(84(61-83-77)81-56-62(5)50-51-82-81)60-76(75)80-49-47-72(90-80)58-74(65-34-42-69(43-35-65)87-54-28-24-20-16-12-8-3)66-36-44-70(45-37-66)88-55-29-25-21-17-13-9-4/h30-51,56-61H,6-29,52-55H2,1-5H3 |
| InChIKey | ALOBVQVRSYBWQE-UHFFFAOYSA-N |
| XLogP | 24.32 |
| TPSA | 67.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 41 |
| Heavy Atoms | 90 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1242.83 |
| LogP ≤ 5 | 24.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|