C35H35ClN2OPd — CID 139262831
chloropalladium(1+);3-[4-(3,5-ditert-butylphenyl)-6-(3-methoxybenzene-6-id-1-yl)-2-pyridinyl]isoquinoline (PubChem CID 139262831) has the molecular formula C35H35ClN2OPd and a molecular weight of 641.55 g/mol. Its IUPAC name is chloropalladium(1+);3-[4-(3,5-ditert-butylphenyl)-6-(3-methoxybenzene-6-id-1-yl)-2-pyridinyl]isoquinoline.
| Compound Name | chloropalladium(1+);3-[4-(3,5-ditert-butylphenyl)-6-(3-methoxybenzene-6-id-1-yl)-2-pyridinyl]isoquinoline |
|---|---|
| PubChem CID | 139262831 |
| Molecular Formula | C35H35ClN2OPd |
| Molecular Weight | 641.55 g/mol |
| Exact Mass | 640.15 |
| IUPAC Name | chloropalladium(1+);3-[4-(3,5-ditert-butylphenyl)-6-(3-methoxybenzene-6-id-1-yl)-2-pyridinyl]isoquinoline |
| SMILES | COc1cc[c-]c(-c2cc(-c3cc(C(C)(C)C)cc(C(C)(C)C)c3)cc(-c3cc4ccccc4cn3)n2)c1.Cl[Pd+] |
| InChI | InChI=1S/C35H35N2O.ClH.Pd/c1-34(2,3)28-15-26(16-29(21-28)35(4,5)6)27-19-31(24-13-10-14-30(17-24)38-7)37-33(20-27)32-18-23-11-8-9-12-25(23)22-36-32;;/h8-12,14-22H,1-7H3;1H;/q-1;;+2/p-1 |
| InChIKey | UQKKWYHHDDOBRT-UHFFFAOYSA-M |
| XLogP | 9.72 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.55 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|