C54H34Br2N6 — CID 139262953
4-[2,7-dibromo-10-[4-(N-phenylanilino)phenyl]quinoxalino[3,2-f][1,10]phenanthrolin-13-yl]-N,N-diphenylaniline (PubChem CID 139262953) has the molecular formula C54H34Br2N6 and a molecular weight of 926.72 g/mol. Its IUPAC name is 4-[2,7-dibromo-10-[4-(N-phenylanilino)phenyl]quinoxalino[3,2-f][1,10]phenanthrolin-13-yl]-N,N-diphenylaniline.
| Compound Name | 4-[2,7-dibromo-10-[4-(N-phenylanilino)phenyl]quinoxalino[3,2-f][1,10]phenanthrolin-13-yl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 139262953 |
| Molecular Formula | C54H34Br2N6 |
| Molecular Weight | 926.72 g/mol |
| Exact Mass | 924.12 |
| IUPAC Name | 4-[2,7-dibromo-10-[4-(N-phenylanilino)phenyl]quinoxalino[3,2-f][1,10]phenanthrolin-13-yl]-N,N-diphenylaniline |
| SMILES | Brc1cnc2c(c1)c1nc3c(-c4ccc(N(c5ccccc5)c5ccccc5)cc4)ccc(-c4ccc(N(c5ccccc5)c5ccccc5)cc4)c3nc1c1cc(Br)cnc12 |
| InChI | InChI=1S/C54H34Br2N6/c55-37-31-47-49(57-33-37)50-48(32-38(56)34-58-50)54-53(47)59-51-45(35-21-25-43(26-22-35)61(39-13-5-1-6-14-39)40-15-7-2-8-16-40)29-30-46(52(51)60-54)36-23-27-44(28-24-36)62(41-17-9-3-10-18-41)42-19-11-4-12-20-42/h1-34H |
| InChIKey | NBDKLESFXBTDIE-UHFFFAOYSA-N |
| XLogP | 15.68 |
| TPSA | 58.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 926.72 |
| LogP ≤ 5 | 15.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|