C19H24O3 — CID 139263690
(3aR,4R,5S,7aS)-4-benzoyl-5-ethyl-3a-hydroxy-7a-methyl-2,3,4,5,6,7-hexahydroinden-1-one (PubChem CID 139263690) has the molecular formula C19H24O3 and a molecular weight of 300.40 g/mol. Its IUPAC name is (3aR,4R,5S,7aS)-4-benzoyl-5-ethyl-3a-hydroxy-7a-methyl-2,3,4,5,6,7-hexahydroinden-1-one.
| Compound Name | (3aR,4R,5S,7aS)-4-benzoyl-5-ethyl-3a-hydroxy-7a-methyl-2,3,4,5,6,7-hexahydroinden-1-one |
|---|---|
| PubChem CID | 139263690 |
| Molecular Formula | C19H24O3 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.17 |
| IUPAC Name | (3aR,4R,5S,7aS)-4-benzoyl-5-ethyl-3a-hydroxy-7a-methyl-2,3,4,5,6,7-hexahydroinden-1-one |
| SMILES | CC[C@H]1CC[C@]2(C)C(=O)CC[C@@]2(O)[C@@H]1C(=O)c1ccccc1 |
| InChI | InChI=1S/C19H24O3/c1-3-13-9-11-18(2)15(20)10-12-19(18,22)16(13)17(21)14-7-5-4-6-8-14/h4-8,13,16,22H,3,9-12H2,1-2H3/t13-,16-,18+,19+/m0/s1 |
| InChIKey | AWZFEVGYMPQXFJ-PTKHLAPESA-N |
| XLogP | 3.41 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |