C16H18IN — CID 139263974
N-[2-(4-iodophenyl)ethyl]-3,5-dimethylaniline (PubChem CID 139263974) has the molecular formula C16H18IN and a molecular weight of 351.23 g/mol. Its IUPAC name is N-[2-(4-iodophenyl)ethyl]-3,5-dimethylaniline.
| Compound Name | N-[2-(4-iodophenyl)ethyl]-3,5-dimethylaniline |
|---|---|
| PubChem CID | 139263974 |
| Molecular Formula | C16H18IN |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | N-[2-(4-iodophenyl)ethyl]-3,5-dimethylaniline |
| SMILES | Cc1cc(C)cc(NCCc2ccc(I)cc2)c1 |
| InChI | InChI=1S/C16H18IN/c1-12-9-13(2)11-16(10-12)18-8-7-14-3-5-15(17)6-4-14/h3-6,9-11,18H,7-8H2,1-2H3 |
| InChIKey | XRSIWHQOGHNNEY-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|