C17H21NO — CID 83457314
4-[3-(3,5-dimethylanilino)propyl]phenol (PubChem CID 83457314) has the molecular formula C17H21NO and a molecular weight of 255.36 g/mol. Its IUPAC name is 4-[3-(3,5-dimethylanilino)propyl]phenol.
| Compound Name | 4-[3-(3,5-dimethylanilino)propyl]phenol |
|---|---|
| PubChem CID | 83457314 |
| Molecular Formula | C17H21NO |
| Molecular Weight | 255.36 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | 4-[3-(3,5-dimethylanilino)propyl]phenol |
| SMILES | Cc1cc(C)cc(NCCCc2ccc(O)cc2)c1 |
| InChI | InChI=1S/C17H21NO/c1-13-10-14(2)12-16(11-13)18-9-3-4-15-5-7-17(19)8-6-15/h5-8,10-12,18-19H,3-4,9H2,1-2H3 |
| InChIKey | BMKDEIGKVFDUBY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.36 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|