C10H8BrF4NO — CID 139264119
4-(4-bromo-2,3,5,6-tetrafluorophenyl)morpholine (PubChem CID 139264119) has the molecular formula C10H8BrF4NO and a molecular weight of 314.08 g/mol. Its IUPAC name is 4-(4-bromo-2,3,5,6-tetrafluorophenyl)morpholine.
| Compound Name | 4-(4-bromo-2,3,5,6-tetrafluorophenyl)morpholine |
|---|---|
| PubChem CID | 139264119 |
| Molecular Formula | C10H8BrF4NO |
| Molecular Weight | 314.08 g/mol |
| Exact Mass | 312.97 |
| IUPAC Name | 4-(4-bromo-2,3,5,6-tetrafluorophenyl)morpholine |
| SMILES | Fc1c(F)c(N2CCOCC2)c(F)c(F)c1Br |
| InChI | InChI=1S/C10H8BrF4NO/c11-5-6(12)8(14)10(9(15)7(5)13)16-1-3-17-4-2-16/h1-4H2 |
| InChIKey | AHTWXJMVXMMIKE-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.08 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|