About carbon monoxide;diethyl(propylidene)azanium;manganese;manganese(2+)
carbon monoxide;diethyl(propylidene)azanium;manganese;manganese(2+) (PubChem CID 139264209) has the molecular formula C15H14Mn2NO8+
and a molecular weight of 446.15 g/mol. Its IUPAC name is carbon monoxide;diethyl(propylidene)azanium;manganese;manganese(2+).
Molecular Properties
| Compound Name | carbon monoxide;diethyl(propylidene)azanium;manganese;manganese(2+) |
| PubChem CID | 139264209 |
| Molecular Formula | C15H14Mn2NO8+ |
| Molecular Weight | 446.15 g/mol |
| Exact Mass | 445.95 |
| IUPAC Name | carbon monoxide;diethyl(propylidene)azanium;manganese;manganese(2+) |
| SMILES | [C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[CH2-][CH-]C=[N+](CC)CC.[Mn+2].[Mn] |
| InChI | InChI=1S/C7H14N.8CO.2Mn/c1-4-7-8(5-2)6-3;8*1-2;;/h4,7H,1,5-6H2,2-3H3;;;;;;;;;;/q-1;;;;;;;;;;+2 |
| InChIKey | VNHKJNKLTRKCLP-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 162.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.15 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze carbon monoxide;diethyl(propylidene)azanium;manganese;manganese(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon monoxide;diethyl(propylidene)azanium;manganese;manganese(2+)?
The IUPAC name of carbon monoxide;diethyl(propylidene)azanium;manganese;manganese(2+) (CID 139264209) is carbon monoxide;diethyl(propylidene)azanium;manganese;manganese(2+).
What is the SMILES notation for carbon monoxide;diethyl(propylidene)azanium;manganese;manganese(2+)?
The canonical SMILES for carbon monoxide;diethyl(propylidene)azanium;manganese;manganese(2+) is [C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[C-]#[O+].[CH2-][CH-]C=[N+](CC)CC.[Mn+2].[Mn].
What is the InChIKey of carbon monoxide;diethyl(propylidene)azanium;manganese;manganese(2+)?
The InChIKey is VNHKJNKLTRKCLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N.8CO.2Mn/c1-4-7-8(5-2)6-3;8*1-2;;/h4,7H,1,5-6H2,2-3H3;;;;;;;;;;/q-1;;;;;;;;;;+2.
What are the key properties of carbon monoxide;diethyl(propylidene)azanium;manganese;manganese(2+)?
carbon monoxide;diethyl(propylidene)azanium;manganese;manganese(2+) has a molecular weight of 446.15 g/mol, XLogP of 0.84, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;diethyl(propylidene)azanium;manganese;manganese(2+) is sourced from PubChem (CID 139264209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).